C19H15ClF4N2O6 — CID 175183863
ethyl 3-[2-chloro-4-fluoro-5-[(2,4,4-trifluoro-3-oxobutanoyl)amino]phenoxy]-4-methoxypyridine-2-carboxylate (PubChem CID 175183863) has the molecular formula C19H15ClF4N2O6 and a molecular weight of 478.78 g/mol. Its IUPAC name is ethyl 3-[2-chloro-4-fluoro-5-[(2,4,4-trifluoro-3-oxobutanoyl)amino]phenoxy]-4-methoxypyridine-2-carboxylate.
| Compound Name | ethyl 3-[2-chloro-4-fluoro-5-[(2,4,4-trifluoro-3-oxobutanoyl)amino]phenoxy]-4-methoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 175183863 |
| Molecular Formula | C19H15ClF4N2O6 |
| Molecular Weight | 478.78 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | ethyl 3-[2-chloro-4-fluoro-5-[(2,4,4-trifluoro-3-oxobutanoyl)amino]phenoxy]-4-methoxypyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nccc(OC)c1Oc1cc(NC(=O)C(F)C(=O)C(F)F)c(F)cc1Cl |
| InChI | InChI=1S/C19H15ClF4N2O6/c1-3-31-19(29)14-16(11(30-2)4-5-25-14)32-12-7-10(9(21)6-8(12)20)26-18(28)13(22)15(27)17(23)24/h4-7,13,17H,3H2,1-2H3,(H,26,28) |
| InChIKey | RAMWHVXSNYYMET-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.78 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|