C16H21NO5 — CID 175186616
1-O-tert-butyl 2-O-ethyl 7-methyl-3-(oxomethylidene)-2H-azepine-1,2-dicarboxylate (PubChem CID 175186616) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl 7-methyl-3-(oxomethylidene)-2H-azepine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl 7-methyl-3-(oxomethylidene)-2H-azepine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 175186616 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl 7-methyl-3-(oxomethylidene)-2H-azepine-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1C(=C=O)C=CC=C(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21NO5/c1-6-21-14(19)13-12(10-18)9-7-8-11(2)17(13)15(20)22-16(3,4)5/h7-9,13H,6H2,1-5H3 |
| InChIKey | IIAXNMJDBZHHMK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|