C12H14N2O2 — CID 175191651
1,5-Diisocyanato-2-methyl-5-propylcyclohexa-1,3-diene (PubChem CID 175191651) has the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. Its IUPAC name is 1,5-diisocyanato-2-methyl-5-propylcyclohexa-1,3-diene.
| Compound Name | 1,5-Diisocyanato-2-methyl-5-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175191651 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1,5-diisocyanato-2-methyl-5-propylcyclohexa-1,3-diene |
| SMILES | CCCC1(CC(=C(C=C1)C)N=C=O)N=C=O |
| InChI | InChI=1S/C12H14N2O2/c1-3-5-12(14-9-16)6-4-10(2)11(7-12)13-8-15/h4,6H,3,5,7H2,1-2H3 |
| InChIKey | MHHGOIPVNQFPRY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 58.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | 424 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|