C25H25FN8O — CID 175193338
N-(2-aminophenyl)-4-[[4-(1-cyclohexyltriazol-4-yl)-5-fluoropyrimidin-2-yl]amino]benzamide (PubChem CID 175193338) has the molecular formula C25H25FN8O and a molecular weight of 472.53 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-(1-cyclohexyltriazol-4-yl)-5-fluoropyrimidin-2-yl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-(1-cyclohexyltriazol-4-yl)-5-fluoropyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 175193338 |
| Molecular Formula | C25H25FN8O |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-(1-cyclohexyltriazol-4-yl)-5-fluoropyrimidin-2-yl]amino]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(Nc2ncc(F)c(-c3cn(C4CCCCC4)nn3)n2)cc1 |
| InChI | InChI=1S/C25H25FN8O/c26-19-14-28-25(31-23(19)22-15-34(33-32-22)18-6-2-1-3-7-18)29-17-12-10-16(11-13-17)24(35)30-21-9-5-4-8-20(21)27/h4-5,8-15,18H,1-3,6-7,27H2,(H,30,35)(H,28,29,31) |
| InChIKey | WTTXQANZHNIXMN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 123.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|