C24H18FN7O — CID 44610993
N-(2-aminophenyl)-4-[(5-fluoro-4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzamide (PubChem CID 44610993) has the molecular formula C24H18FN7O and a molecular weight of 439.45 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(5-fluoro-4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(5-fluoro-4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 44610993 |
| Molecular Formula | C24H18FN7O |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-(2-aminophenyl)-4-[(5-fluoro-4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(Nc2ncc(F)c(-c3cnc4ccccn34)n2)cc1 |
| InChI | InChI=1S/C24H18FN7O/c25-17-13-28-24(31-22(17)20-14-27-21-7-3-4-12-32(20)21)29-16-10-8-15(9-11-16)23(33)30-19-6-2-1-5-18(19)26/h1-14H,26H2,(H,30,33)(H,28,29,31) |
| InChIKey | UAIZTGGWFPKBGW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|