C26H20N8O2S — CID 58163785
N-(2-aminophenyl)-4-[[4-(7-imidazol-1-yloxyimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide (PubChem CID 58163785) has the molecular formula C26H20N8O2S and a molecular weight of 508.57 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-(7-imidazol-1-yloxyimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-(7-imidazol-1-yloxyimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 58163785 |
| Molecular Formula | C26H20N8O2S |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-(7-imidazol-1-yloxyimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(Nc2nc(-c3cnc4cc(On5ccnc5)ccn34)cs2)cc1 |
| InChI | InChI=1S/C26H20N8O2S/c27-20-3-1-2-4-21(20)31-25(35)17-5-7-18(8-6-17)30-26-32-22(15-37-26)23-14-29-24-13-19(9-11-34(23)24)36-33-12-10-28-16-33/h1-16H,27H2,(H,30,32)(H,31,35) |
| InChIKey | NNGKIFCGUBGBKF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|