C28H27N7O2S — CID 25154045
N-(2-aminophenyl)-4-[[4-[7-(morpholin-4-ylmethyl)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide (PubChem CID 25154045) has the molecular formula C28H27N7O2S and a molecular weight of 525.64 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-[7-(morpholin-4-ylmethyl)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-[7-(morpholin-4-ylmethyl)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 25154045 |
| Molecular Formula | C28H27N7O2S |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-[7-(morpholin-4-ylmethyl)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(Nc2nc(-c3cnc4cc(CN5CCOCC5)ccn34)cs2)cc1 |
| InChI | InChI=1S/C28H27N7O2S/c29-22-3-1-2-4-23(22)32-27(36)20-5-7-21(8-6-20)31-28-33-24(18-38-28)25-16-30-26-15-19(9-10-35(25)26)17-34-11-13-37-14-12-34/h1-10,15-16,18H,11-14,17,29H2,(H,31,33)(H,32,36) |
| InChIKey | HZIXQNQQJZZZIO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|