C26H25N7OS — CID 58163728
N-(2-aminophenyl)-4-[[4-[5-(ethylaminomethyl)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide (PubChem CID 58163728) has the molecular formula C26H25N7OS and a molecular weight of 483.60 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-[5-(ethylaminomethyl)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-[5-(ethylaminomethyl)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 58163728 |
| Molecular Formula | C26H25N7OS |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-[5-(ethylaminomethyl)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]amino]benzamide |
| SMILES | CCNCc1cccc2ncc(-c3csc(Nc4ccc(C(=O)Nc5ccccc5N)cc4)n3)n12 |
| InChI | InChI=1S/C26H25N7OS/c1-2-28-14-19-6-5-9-24-29-15-23(33(19)24)22-16-35-26(32-22)30-18-12-10-17(11-13-18)25(34)31-21-8-4-3-7-20(21)27/h3-13,15-16,28H,2,14,27H2,1H3,(H,30,32)(H,31,34) |
| InChIKey | KJMJMWSAKPTSLB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|