C24H19FN6OS — CID 58163762
N-(2-aminophenyl)-4-[[4-(8-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide (PubChem CID 58163762) has the molecular formula C24H19FN6OS and a molecular weight of 458.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-(8-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-(8-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 58163762 |
| Molecular Formula | C24H19FN6OS |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-(8-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide |
| SMILES | Cc1nc2c(F)cccn2c1-c1csc(Nc2ccc(C(=O)Nc3ccccc3N)cc2)n1 |
| InChI | InChI=1S/C24H19FN6OS/c1-14-21(31-12-4-5-17(25)22(31)27-14)20-13-33-24(30-20)28-16-10-8-15(9-11-16)23(32)29-19-7-3-2-6-18(19)26/h2-13H,26H2,1H3,(H,28,30)(H,29,32) |
| InChIKey | ABPIQRQEAOAWPH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|