C13H22F3N2O5S2+ — CID 175193429
trifluoromethylsulfonyl 1-(3-methylimidazol-3-ium-1-yl)octane-1-sulfonate (PubChem CID 175193429) has the molecular formula C13H22F3N2O5S2+ and a molecular weight of 407.46 g/mol. Its IUPAC name is trifluoromethylsulfonyl 1-(3-methylimidazol-3-ium-1-yl)octane-1-sulfonate.
| Compound Name | trifluoromethylsulfonyl 1-(3-methylimidazol-3-ium-1-yl)octane-1-sulfonate |
|---|---|
| PubChem CID | 175193429 |
| Molecular Formula | C13H22F3N2O5S2+ |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | trifluoromethylsulfonyl 1-(3-methylimidazol-3-ium-1-yl)octane-1-sulfonate |
| SMILES | CCCCCCCC(n1cc[n+](C)c1)S(=O)(=O)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H22F3N2O5S2/c1-3-4-5-6-7-8-12(18-10-9-17(2)11-18)24(19,20)23-25(21,22)13(14,15)16/h9-12H,3-8H2,1-2H3/q+1 |
| InChIKey | OJIGDUJUQUJGRT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|