C25H25N3O — CID 175193741
N-(2-aminophenyl)-4-[[(3-methylphenyl)methyl-prop-2-ynylamino]methyl]benzamide (PubChem CID 175193741) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[(3-methylphenyl)methyl-prop-2-ynylamino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[(3-methylphenyl)methyl-prop-2-ynylamino]methyl]benzamide |
|---|---|
| PubChem CID | 175193741 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-(2-aminophenyl)-4-[[(3-methylphenyl)methyl-prop-2-ynylamino]methyl]benzamide |
| SMILES | C#CCN(Cc1ccc(C(=O)Nc2ccccc2N)cc1)Cc1cccc(C)c1 |
| InChI | InChI=1S/C25H25N3O/c1-3-15-28(18-21-8-6-7-19(2)16-21)17-20-11-13-22(14-12-20)25(29)27-24-10-5-4-9-23(24)26/h1,4-14,16H,15,17-18,26H2,2H3,(H,27,29) |
| InChIKey | CQDRZMJNBGYZTF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|