C18H16Cl2N2O2 — CID 175205773
4-[[(2,6-dichlorophenyl)methyl-prop-2-ynylamino]methyl]-N-hydroxybenzamide (PubChem CID 175205773) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is 4-[[(2,6-dichlorophenyl)methyl-prop-2-ynylamino]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[(2,6-dichlorophenyl)methyl-prop-2-ynylamino]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 175205773 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 4-[[(2,6-dichlorophenyl)methyl-prop-2-ynylamino]methyl]-N-hydroxybenzamide |
| SMILES | C#CCN(Cc1ccc(C(=O)NO)cc1)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H16Cl2N2O2/c1-2-10-22(12-15-16(19)4-3-5-17(15)20)11-13-6-8-14(9-7-13)18(23)21-24/h1,3-9,24H,10-12H2,(H,21,23) |
| InChIKey | CMPQPGQNGNRHKZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|