C7H14N2O6S — CID 175196309
2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide;methanesulfonic acid (PubChem CID 175196309) has the molecular formula C7H14N2O6S and a molecular weight of 254.26 g/mol. Its IUPAC name is 2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide;methanesulfonic acid.
| Compound Name | 2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide;methanesulfonic acid |
|---|---|
| PubChem CID | 175196309 |
| Molecular Formula | C7H14N2O6S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-(4-hydroxy-2-oxopyrrolidin-1-yl)acetamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NC(=O)CN1CC(O)CC1=O |
| InChI | InChI=1S/C6H10N2O3.CH4O3S/c7-5(10)3-8-2-4(9)1-6(8)11;1-5(2,3)4/h4,9H,1-3H2,(H2,7,10);1H3,(H,2,3,4) |
| InChIKey | ZWZCBDSXBLPRGQ-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|