C9H16N2O4 — CID 91411764
2-[4-(2,2-dihydroxypropyl)-2-oxopyrrolidin-1-yl]acetamide (PubChem CID 91411764) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-[4-(2,2-dihydroxypropyl)-2-oxopyrrolidin-1-yl]acetamide.
| Compound Name | 2-[4-(2,2-dihydroxypropyl)-2-oxopyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 91411764 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-[4-(2,2-dihydroxypropyl)-2-oxopyrrolidin-1-yl]acetamide |
| SMILES | CC(O)(O)CC1CC(=O)N(CC(N)=O)C1 |
| InChI | InChI=1S/C9H16N2O4/c1-9(14,15)3-6-2-8(13)11(4-6)5-7(10)12/h6,14-15H,2-5H2,1H3,(H2,10,12) |
| InChIKey | DEPUCNHYITXDAK-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|