C15H14Cl2O6 — CID 175196935
2-[4-[2-(3,5-dichlorophenyl)ethoxy]-2-methylidene-4-oxobutanoyl]oxyacetic acid (PubChem CID 175196935) has the molecular formula C15H14Cl2O6 and a molecular weight of 361.18 g/mol. Its IUPAC name is 2-[4-[2-(3,5-dichlorophenyl)ethoxy]-2-methylidene-4-oxobutanoyl]oxyacetic acid.
| Compound Name | 2-[4-[2-(3,5-dichlorophenyl)ethoxy]-2-methylidene-4-oxobutanoyl]oxyacetic acid |
|---|---|
| PubChem CID | 175196935 |
| Molecular Formula | C15H14Cl2O6 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 2-[4-[2-(3,5-dichlorophenyl)ethoxy]-2-methylidene-4-oxobutanoyl]oxyacetic acid |
| SMILES | C=C(CC(=O)OCCc1cc(Cl)cc(Cl)c1)C(=O)OCC(=O)O |
| InChI | InChI=1S/C15H14Cl2O6/c1-9(15(21)23-8-13(18)19)4-14(20)22-3-2-10-5-11(16)7-12(17)6-10/h5-7H,1-4,8H2,(H,18,19) |
| InChIKey | CUWMFSPLZCGOLR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|