C11H19B3NO2 — CID 175197170
CID 175197170 (PubChem CID 175197170) has the molecular formula C11H19B3NO2 and a molecular weight of 229.71 g/mol.
| Compound Name | CID 175197170 |
|---|---|
| PubChem CID | 175197170 |
| Molecular Formula | C11H19B3NO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | — |
| SMILES | O=C(O)CCC[C@@H]1CN2CCC1CC2.[B].[B].[B] |
| InChI | InChI=1S/C11H19NO2.3B/c13-11(14)3-1-2-10-8-12-6-4-9(10)5-7-12;;;/h9-10H,1-8H2,(H,13,14);;;/t10-;;;/m1.../s1 |
| InChIKey | MCCYCEGADVUKMQ-FYBBWCNBSA-N |
| XLogP | 0.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|