C58H92N8O4 — CID 173330743
4-[8-(3-carboxypropyl)-14,17,23,26,32,35-hexakis(prop-2-enyl)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl]butanoic acid (PubChem CID 173330743) has the molecular formula C58H92N8O4 and a molecular weight of 965.43 g/mol. Its IUPAC name is 4-[8-(3-carboxypropyl)-14,17,23,26,32,35-hexakis(prop-2-enyl)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl]butanoic acid.
| Compound Name | 4-[8-(3-carboxypropyl)-14,17,23,26,32,35-hexakis(prop-2-enyl)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl]butanoic acid |
|---|---|
| PubChem CID | 173330743 |
| Molecular Formula | C58H92N8O4 |
| Molecular Weight | 965.43 g/mol |
| Exact Mass | 964.72 |
| IUPAC Name | 4-[8-(3-carboxypropyl)-14,17,23,26,32,35-hexakis(prop-2-enyl)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl]butanoic acid |
| SMILES | C=CCC1CCC(CC=C)C2C3NC(NC4NC(NC5NC(NC6NC(N3)C3C(CC=C)CCC(CC=C)C63)C3C(CCCC(=O)O)CCC(CCCC(=O)O)C53)C3C(CC=C)CCC(CC=C)C43)C12 |
| InChI | InChI=1S/C58H92N8O4/c1-7-15-33-25-26-34(16-8-2)44-43(33)51-59-52(44)61-54-46-36(18-10-4)28-30-38(20-12-6)48(46)56(63-54)65-58-50-40(22-14-24-42(69)70)32-31-39(21-13-23-41(67)68)49(50)57(66-58)64-55-47-37(19-11-5)29-27-35(17-9-3)45(47)53(60-51)62-55/h7-12,33-40,43-66H,1-6,13-32H2,(H,67,68)(H,69,70) |
| InChIKey | GOYZPSNWZBRLJP-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 170.84 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.43 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|