C96H168N8 — CID 91154781
5,8,14,17,23,26,32,35-octakis(oct-7-enyl)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 91154781) has the molecular formula C96H168N8 and a molecular weight of 1434.46 g/mol. Its IUPAC name is 5,8,14,17,23,26,32,35-octakis(oct-7-enyl)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 5,8,14,17,23,26,32,35-octakis(oct-7-enyl)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 91154781 |
| Molecular Formula | C96H168N8 |
| Molecular Weight | 1434.46 g/mol |
| Exact Mass | 1433.34 |
| IUPAC Name | 5,8,14,17,23,26,32,35-octakis(oct-7-enyl)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | C=CCCCCCCC1CCC(CCCCCCC=C)C2C3NC(NC4NC(NC5NC(NC6NC(N3)C3C(CCCCCCC=C)CCC(CCCCCCC=C)C63)C3C(CCCCCCC=C)CCC(CCCCCCC=C)C53)C3C(CCCCCCC=C)CCC(CCCCCCC=C)C43)C12 |
| InChI | InChI=1S/C96H168N8/c1-9-17-25-33-41-49-57-73-65-66-74(58-50-42-34-26-18-10-2)82-81(73)89-97-90(82)102-92-85-77(61-53-45-37-29-21-13-5)69-70-78(62-54-46-38-30-22-14-6)86(85)94(99-92)104-96-88-80(64-56-48-40-32-24-16-8)72-71-79(63-55-47-39-31-23-15-7)87(88)95(100-96)103-93-84-76(60-52-44-36-28-20-12-4)68-67-75(83(84)91(98-93)101-89)59-51-43-35-27-19-11-3/h9-16,73-104H,1-8,17-72H2 |
| InChIKey | DIPIYANFDYDZDY-UHFFFAOYSA-N |
| XLogP | 24.63 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 56 |
| Heavy Atoms | 104 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1434.46 |
| LogP ≤ 5 | 24.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|