C12H21NO5 — CID 45110293
4-[(1S,6S,7S,8R)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]butanoic acid (PubChem CID 45110293) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is 4-[(1S,6S,7S,8R)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]butanoic acid.
| Compound Name | 4-[(1S,6S,7S,8R)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]butanoic acid |
|---|---|
| PubChem CID | 45110293 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-[(1S,6S,7S,8R)-1,7,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]butanoic acid |
| SMILES | O=C(O)CCC[C@H]1CN2CC[C@H](O)C2[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H21NO5/c14-8-4-5-13-6-7(2-1-3-9(15)16)11(17)12(18)10(8)13/h7-8,10-12,14,17-18H,1-6H2,(H,15,16)/t7-,8-,10?,11-,12+/m0/s1 |
| InChIKey | ADKJHHZFNSOBAG-QXDXODDNSA-N |
| XLogP | -0.97 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |