C12H21NO3 — CID 159763396
(1S,6S,7R,8R,8aR)-6-but-3-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine-1,7,8-triol (PubChem CID 159763396) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is (1S,6S,7R,8R,8aR)-6-but-3-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine-1,7,8-triol.
| Compound Name | (1S,6S,7R,8R,8aR)-6-but-3-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine-1,7,8-triol |
|---|---|
| PubChem CID | 159763396 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (1S,6S,7R,8R,8aR)-6-but-3-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine-1,7,8-triol |
| SMILES | C=CCC[C@H]1CN2CC[C@H](O)[C@@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H21NO3/c1-2-3-4-8-7-13-6-5-9(14)10(13)12(16)11(8)15/h2,8-12,14-16H,1,3-7H2/t8-,9-,10+,11+,12+/m0/s1 |
| InChIKey | NFENHVZWPSOHJZ-PREPNJAASA-N |
| XLogP | -0.26 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|