About butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum
butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum (PubChem CID 175197197) has the molecular formula C10H21MoNOS2
and a molecular weight of 331.36 g/mol. Its IUPAC name is butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum.
Molecular Properties
| Compound Name | butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum |
| PubChem CID | 175197197 |
| Molecular Formula | C10H21MoNOS2 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum |
| SMILES | CCCCCN(SCCCC)C(O)=S.[Mo] |
| InChI | InChI=1S/C10H21NOS2.Mo/c1-3-5-7-8-11(10(12)13)14-9-6-4-2;/h3-9H2,1-2H3,(H,12,13); |
| InChIKey | ZXHSACVPPBCAGV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum?
The IUPAC name of butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum (CID 175197197) is butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum.
What is the SMILES notation for butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum?
The canonical SMILES for butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum is CCCCCN(SCCCC)C(O)=S.[Mo].
What is the InChIKey of butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum?
The InChIKey is ZXHSACVPPBCAGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NOS2.Mo/c1-3-5-7-8-11(10(12)13)14-9-6-4-2;/h3-9H2,1-2H3,(H,12,13);.
What are the key properties of butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum?
butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum has a molecular weight of 331.36 g/mol, XLogP of 3.77, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butylsulfanyl(pentyl)carbamothioic O-acid;molybdenum is sourced from PubChem (CID 175197197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).