C5H2FN — CID 175200961
2-fluoro-3-azabicyclo[3.1.0]hexa-1,3,5-triene (PubChem CID 175200961) has the molecular formula C5H2FN and a molecular weight of 95.08 g/mol. Its IUPAC name is 2-fluoro-3-azabicyclo[3.1.0]hexa-1,3,5-triene.
| Compound Name | 2-fluoro-3-azabicyclo[3.1.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 175200961 |
| Molecular Formula | C5H2FN |
| Molecular Weight | 95.08 g/mol |
| Exact Mass | 95.02 |
| IUPAC Name | 2-fluoro-3-azabicyclo[3.1.0]hexa-1,3,5-triene |
| SMILES | Fc1ncc2cc1-2 |
| InChI | InChI=1S/C5H2FN/c6-5-4-1-3(4)2-7-5/h1-2H |
| InChIKey | VXTBXOODYPWIHP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 95.08 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|