About 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide
3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide (PubChem CID 175201452) has the molecular formula C16H17Br2N3O5
and a molecular weight of 491.14 g/mol. Its IUPAC name is 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide.
Molecular Properties
| Compound Name | 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide |
| PubChem CID | 175201452 |
| Molecular Formula | C16H17Br2N3O5 |
| Molecular Weight | 491.14 g/mol |
| Exact Mass | 488.95 |
| IUPAC Name | 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])c(NC(C)=O)cc1Br.COc1ccc(N)cc1Br |
| InChI | InChI=1S/C9H9BrN2O4.C7H8BrNO/c1-5(13)11-7-3-6(10)9(16-2)4-8(7)12(14)15;1-10-7-3-2-5(9)4-6(7)8/h3-4H,1-2H3,(H,11,13);2-4H,9H2,1H3 |
| InChIKey | IBNCSNIEOUMJHW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.14 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide?
The IUPAC name of 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide (CID 175201452) is 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide.
What is the SMILES notation for 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide?
The canonical SMILES for 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide is COc1cc([N+](=O)[O-])c(NC(C)=O)cc1Br.COc1ccc(N)cc1Br.
What is the InChIKey of 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide?
The InChIKey is IBNCSNIEOUMJHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2O4.C7H8BrNO/c1-5(13)11-7-3-6(10)9(16-2)4-8(7)12(14)15;1-10-7-3-2-5(9)4-6(7)8/h3-4H,1-2H3,(H,11,13);2-4H,9H2,1H3.
What are the key properties of 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide?
3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide has a molecular weight of 491.14 g/mol, XLogP of 4.36, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-methoxyaniline;N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide is sourced from PubChem (CID 175201452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).