C19H30N4O2 — CID 175201524
7-[5-[(3S)-3-(methylamino)pyrrolidin-1-yl]pentyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylic acid (PubChem CID 175201524) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 7-[5-[(3S)-3-(methylamino)pyrrolidin-1-yl]pentyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylic acid.
| Compound Name | 7-[5-[(3S)-3-(methylamino)pyrrolidin-1-yl]pentyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 175201524 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 7-[5-[(3S)-3-(methylamino)pyrrolidin-1-yl]pentyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylic acid |
| SMILES | CN[C@H]1CCN(CCCCCc2ccc3c(n2)N(C(=O)O)CCC3)C1 |
| InChI | InChI=1S/C19H30N4O2/c1-20-17-10-13-22(14-17)11-4-2-3-7-16-9-8-15-6-5-12-23(19(24)25)18(15)21-16/h8-9,17,20H,2-7,10-14H2,1H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | LMMKAIOMTFVEEL-KRWDZBQOSA-N |
| XLogP | 2.52 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|