C13H15N5O5 — CID 175201602
3-[[3-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-7H-purin-2-yl]amino]prop-2-enal (PubChem CID 175201602) has the molecular formula C13H15N5O5 and a molecular weight of 321.29 g/mol. Its IUPAC name is 3-[[3-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-7H-purin-2-yl]amino]prop-2-enal.
| Compound Name | 3-[[3-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-7H-purin-2-yl]amino]prop-2-enal |
|---|---|
| PubChem CID | 175201602 |
| Molecular Formula | C13H15N5O5 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-[[3-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-7H-purin-2-yl]amino]prop-2-enal |
| SMILES | O=CC=CNc1nc(=O)c2[nH]cnc2n1[C@@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C13H15N5O5/c19-3-1-2-14-13-17-12(22)10-11(16-6-15-10)18(13)9-4-7(21)8(5-20)23-9/h1-3,6-9,20-21H,4-5H2,(H,15,16)(H,14,17,22)/t7-,8+,9-/m0/s1 |
| InChIKey | QAEVUMVWHPSKHO-YIZRAAEISA-N |
| XLogP | -1.12 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|