C11H8Cl2FNaO3 — CID 175204065
sodium;hydride;methyl 2-(2,4-dichloro-5-fluorobenzoyl)prop-2-enoate (PubChem CID 175204065) has the molecular formula C11H8Cl2FNaO3 and a molecular weight of 301.08 g/mol. Its IUPAC name is sodium;hydride;methyl 2-(2,4-dichloro-5-fluorobenzoyl)prop-2-enoate.
| Compound Name | sodium;hydride;methyl 2-(2,4-dichloro-5-fluorobenzoyl)prop-2-enoate |
|---|---|
| PubChem CID | 175204065 |
| Molecular Formula | C11H8Cl2FNaO3 |
| Molecular Weight | 301.08 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | sodium;hydride;methyl 2-(2,4-dichloro-5-fluorobenzoyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(=O)c1cc(F)c(Cl)cc1Cl.[H-].[Na+] |
| InChI | InChI=1S/C11H7Cl2FO3.Na.H/c1-5(11(16)17-2)10(15)6-3-9(14)8(13)4-7(6)12;;/h3-4H,1H2,2H3;;/q;+1;-1 |
| InChIKey | ZPVBINYMOZYAQK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.08 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|