sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate

C9H4Cl2FNaO2 — CID 76951522

IUPACsodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate
SMILESO=C(C=C[O-])c1cc(F)c(Cl)cc1Cl.[Na+]
InChIInChI=1S/C9H5Cl2FO2.Na/c10-6-4-7(11)8(12)3-5(6)9(14)1-2-13;/h1-4,13H;/q;+1/p-1
InChIKeyUIYULCVBUBAWHY-UHFFFAOYSA-M
MW257.02 g/mol
LogP-0.81
Rot. Bonds2

About sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate

sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate (PubChem CID 76951522) has the molecular formula C9H4Cl2FNaO2 and a molecular weight of 257.02 g/mol. Its IUPAC name is sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate.

Molecular Properties

Compound Namesodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate
PubChem CID76951522
Molecular FormulaC9H4Cl2FNaO2
Molecular Weight257.02 g/mol
Exact Mass255.95
IUPAC Namesodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate
SMILESO=C(C=C[O-])c1cc(F)c(Cl)cc1Cl.[Na+]
InChIInChI=1S/C9H5Cl2FO2.Na/c10-6-4-7(11)8(12)3-5(6)9(14)1-2-13;/h1-4,13H;/q;+1/p-1
InChIKeyUIYULCVBUBAWHY-UHFFFAOYSA-M
XLogP-0.81
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.02
LogP ≤ 5-0.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate?
The IUPAC name of sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate (CID 76951522) is sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate.
What is the SMILES notation for sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate?
The canonical SMILES for sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate is O=C(C=C[O-])c1cc(F)c(Cl)cc1Cl.[Na+].
What is the InChIKey of sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate?
The InChIKey is UIYULCVBUBAWHY-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H5Cl2FO2.Na/c10-6-4-7(11)8(12)3-5(6)9(14)1-2-13;/h1-4,13H;/q;+1/p-1.
What are the key properties of sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate?
sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate has a molecular weight of 257.02 g/mol, XLogP of -0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate is sourced from PubChem (CID 76951522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).