C9H4Cl2FNaO2 — CID 76951522
sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate (PubChem CID 76951522) has the molecular formula C9H4Cl2FNaO2 and a molecular weight of 257.02 g/mol. Its IUPAC name is sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate.
| Compound Name | sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate |
|---|---|
| PubChem CID | 76951522 |
| Molecular Formula | C9H4Cl2FNaO2 |
| Molecular Weight | 257.02 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | sodium 3-(2,4-dichloro-5-fluorophenyl)-3-oxoprop-1-en-1-olate |
| SMILES | O=C(C=C[O-])c1cc(F)c(Cl)cc1Cl.[Na+] |
| InChI | InChI=1S/C9H5Cl2FO2.Na/c10-6-4-7(11)8(12)3-5(6)9(14)1-2-13;/h1-4,13H;/q;+1/p-1 |
| InChIKey | UIYULCVBUBAWHY-UHFFFAOYSA-M |
| XLogP | -0.81 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.02 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|