C19H23F2N3O2 — CID 175207841
2-[7-(3,4-dimethylpiperazin-1-yl)-1-ethyl-6,8-difluoro-4-oxoquinolin-3-yl]acetaldehyde (PubChem CID 175207841) has the molecular formula C19H23F2N3O2 and a molecular weight of 363.41 g/mol. Its IUPAC name is 2-[7-(3,4-dimethylpiperazin-1-yl)-1-ethyl-6,8-difluoro-4-oxoquinolin-3-yl]acetaldehyde.
| Compound Name | 2-[7-(3,4-dimethylpiperazin-1-yl)-1-ethyl-6,8-difluoro-4-oxoquinolin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 175207841 |
| Molecular Formula | C19H23F2N3O2 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-[7-(3,4-dimethylpiperazin-1-yl)-1-ethyl-6,8-difluoro-4-oxoquinolin-3-yl]acetaldehyde |
| SMILES | CCn1cc(CC=O)c(=O)c2cc(F)c(N3CCN(C)C(C)C3)c(F)c21 |
| InChI | InChI=1S/C19H23F2N3O2/c1-4-23-11-13(5-8-25)19(26)14-9-15(20)18(16(21)17(14)23)24-7-6-22(3)12(2)10-24/h8-9,11-12H,4-7,10H2,1-3H3 |
| InChIKey | TUHDRPJHMFJUPV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|