C26H30F2N6OS — CID 172956603
1-[(E)-[7-(4,5-dimethyl-1,4-diazepan-1-yl)-1-ethyl-6,8-difluoro-4-oxoquinolin-3-yl]methylideneamino]-3-phenylthiourea (PubChem CID 172956603) has the molecular formula C26H30F2N6OS and a molecular weight of 512.63 g/mol. Its IUPAC name is 1-[(E)-[7-(4,5-dimethyl-1,4-diazepan-1-yl)-1-ethyl-6,8-difluoro-4-oxoquinolin-3-yl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-[7-(4,5-dimethyl-1,4-diazepan-1-yl)-1-ethyl-6,8-difluoro-4-oxoquinolin-3-yl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 172956603 |
| Molecular Formula | C26H30F2N6OS |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 1-[(E)-[7-(4,5-dimethyl-1,4-diazepan-1-yl)-1-ethyl-6,8-difluoro-4-oxoquinolin-3-yl]methylideneamino]-3-phenylthiourea |
| SMILES | CCn1cc(/C=N/NC(=S)Nc2ccccc2)c(=O)c2cc(F)c(N3CCC(C)N(C)CC3)c(F)c21 |
| InChI | InChI=1S/C26H30F2N6OS/c1-4-33-16-18(15-29-31-26(36)30-19-8-6-5-7-9-19)25(35)20-14-21(27)24(22(28)23(20)33)34-11-10-17(2)32(3)12-13-34/h5-9,14-17H,4,10-13H2,1-3H3,(H2,30,31,36)/b29-15+ |
| InChIKey | AXPXBIYUMSOCDM-WKULSOCRSA-N |
| XLogP | 4.15 |
| TPSA | 64.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|