About 2-hydroxybenzoic acid;thiomorpholine
2-hydroxybenzoic acid;thiomorpholine (PubChem CID 175209490) has the molecular formula C11H15NO3S
and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;thiomorpholine.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;thiomorpholine |
| PubChem CID | 175209490 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2-hydroxybenzoic acid;thiomorpholine |
| SMILES | C1CSCCN1.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C7H6O3.C4H9NS/c8-6-4-2-1-3-5(6)7(9)10;1-3-6-4-2-5-1/h1-4,8H,(H,9,10);5H,1-4H2 |
| InChIKey | YDYDQHCROZRVDK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxybenzoic acid;thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;thiomorpholine?
The IUPAC name of 2-hydroxybenzoic acid;thiomorpholine (CID 175209490) is 2-hydroxybenzoic acid;thiomorpholine.
What is the SMILES notation for 2-hydroxybenzoic acid;thiomorpholine?
The canonical SMILES for 2-hydroxybenzoic acid;thiomorpholine is C1CSCCN1.O=C(O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzoic acid;thiomorpholine?
The InChIKey is YDYDQHCROZRVDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C4H9NS/c8-6-4-2-1-3-5(6)7(9)10;1-3-6-4-2-5-1/h1-4,8H,(H,9,10);5H,1-4H2.
What are the key properties of 2-hydroxybenzoic acid;thiomorpholine?
2-hydroxybenzoic acid;thiomorpholine has a molecular weight of 241.31 g/mol, XLogP of 1.41, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;thiomorpholine is sourced from PubChem (CID 175209490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).