C5H7N2O5S- — CID 175211409
3-(sulfinatocarbamoylcarbamoyloxy)prop-1-ene (PubChem CID 175211409) has the molecular formula C5H7N2O5S- and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-(sulfinatocarbamoylcarbamoyloxy)prop-1-ene.
| Compound Name | 3-(sulfinatocarbamoylcarbamoyloxy)prop-1-ene |
|---|---|
| PubChem CID | 175211409 |
| Molecular Formula | C5H7N2O5S- |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 3-(sulfinatocarbamoylcarbamoyloxy)prop-1-ene |
| SMILES | C=CCOC(=O)NC(=O)NS(=O)[O-] |
| InChI | InChI=1S/C5H8N2O5S/c1-2-3-12-5(9)6-4(8)7-13(10)11/h2H,1,3H2,(H,10,11)(H2,6,7,8,9)/p-1 |
| InChIKey | FVTSMNKAQQTWIK-UHFFFAOYSA-M |
| XLogP | -0.60 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|