About (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate
(2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate (PubChem CID 175211690) has the molecular formula C14H17BrN2O4
and a molecular weight of 357.20 g/mol. Its IUPAC name is (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate |
| PubChem CID | 175211690 |
| Molecular Formula | C14H17BrN2O4 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)N2CCNCC2)c(Br)c1C |
| InChI | InChI=1S/C14H17BrN2O4/c1-9-10(13(18)20-2)3-4-11(12(9)15)21-14(19)17-7-5-16-6-8-17/h3-4,16H,5-8H2,1-2H3 |
| InChIKey | SNOKPQQOYLLTCM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate?
The IUPAC name of (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate (CID 175211690) is (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate.
What is the SMILES notation for (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate?
The canonical SMILES for (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate is COC(=O)c1ccc(OC(=O)N2CCNCC2)c(Br)c1C.
What is the InChIKey of (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate?
The InChIKey is SNOKPQQOYLLTCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN2O4/c1-9-10(13(18)20-2)3-4-11(12(9)15)21-14(19)17-7-5-16-6-8-17/h3-4,16H,5-8H2,1-2H3.
What are the key properties of (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate?
(2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate has a molecular weight of 357.20 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4-methoxycarbonyl-3-methylphenyl) piperazine-1-carboxylate is sourced from PubChem (CID 175211690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).