About (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate
(3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate (PubChem CID 175212468) has the molecular formula C15H30B2F8O3P2-2
and a molecular weight of 493.96 g/mol. Its IUPAC name is (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate.
Molecular Properties
| Compound Name | (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate |
| PubChem CID | 175212468 |
| Molecular Formula | C15H30B2F8O3P2-2 |
| Molecular Weight | 493.96 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate |
| SMILES | F[B-](F)(F)F.F[B-](F)(F)F.O=P(O)(O)CCC(P)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C15H30O3P2.2BF4/c16-20(17,18)12-11-15(19,13-7-3-1-4-8-13)14-9-5-2-6-10-14;2*2-1(3,4)5/h13-14H,1-12,19H2,(H2,16,17,18);;/q;2*-1 |
| InChIKey | IEJZQJPJPVCPLM-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.96 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate?
The IUPAC name of (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate (CID 175212468) is (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate.
What is the SMILES notation for (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate?
The canonical SMILES for (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate is F[B-](F)(F)F.F[B-](F)(F)F.O=P(O)(O)CCC(P)(C1CCCCC1)C1CCCCC1.
What is the InChIKey of (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate?
The InChIKey is IEJZQJPJPVCPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3P2.2BF4/c16-20(17,18)12-11-15(19,13-7-3-1-4-8-13)14-9-5-2-6-10-14;2*2-1(3,4)5/h13-14H,1-12,19H2,(H2,16,17,18);;/q;2*-1.
What are the key properties of (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate?
(3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate has a molecular weight of 493.96 g/mol, XLogP of 6.93, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dicyclohexyl-3-phosphanylpropyl)phosphonic acid ditetrafluoroborate is sourced from PubChem (CID 175212468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).