C9H12N2O3Se — CID 175213617
3-(2-methylselanylmorpholin-4-yl)pyrrole-2,5-dione (PubChem CID 175213617) has the molecular formula C9H12N2O3Se and a molecular weight of 275.17 g/mol. Its IUPAC name is 3-(2-methylselanylmorpholin-4-yl)pyrrole-2,5-dione.
| Compound Name | 3-(2-methylselanylmorpholin-4-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 175213617 |
| Molecular Formula | C9H12N2O3Se |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 3-(2-methylselanylmorpholin-4-yl)pyrrole-2,5-dione |
| SMILES | C[Se]C1CN(C2=CC(=O)NC2=O)CCO1 |
| InChI | InChI=1S/C9H12N2O3Se/c1-15-8-5-11(2-3-14-8)6-4-7(12)10-9(6)13/h4,8H,2-3,5H2,1H3,(H,10,12,13) |
| InChIKey | RZEQNBQFQQPBJK-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|