C20H26F2N2O3 — CID 175216573
methyl 4-(4-benzyl-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)-2,2-dimethyl-4-oxobutanoate (PubChem CID 175216573) has the molecular formula C20H26F2N2O3 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl 4-(4-benzyl-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)-2,2-dimethyl-4-oxobutanoate.
| Compound Name | methyl 4-(4-benzyl-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)-2,2-dimethyl-4-oxobutanoate |
|---|---|
| PubChem CID | 175216573 |
| Molecular Formula | C20H26F2N2O3 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | methyl 4-(4-benzyl-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)-2,2-dimethyl-4-oxobutanoate |
| SMILES | COC(=O)C(C)(C)CC(=O)N1CCC2C1C(F)(F)CN2Cc1ccccc1 |
| InChI | InChI=1S/C20H26F2N2O3/c1-19(2,18(26)27-3)11-16(25)24-10-9-15-17(24)20(21,22)13-23(15)12-14-7-5-4-6-8-14/h4-8,15,17H,9-13H2,1-3H3 |
| InChIKey | CSGJJPCTQXMMKF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |