C25H28F2N2O3 — CID 163284126
benzyl 3-[(3aR,6aR)-1-benzyl-3,3-difluoro-3a,4,6,6a-tetrahydro-2H-pyrrolo[3,4-b]pyrrol-5-yl]-2,2-dimethyl-3-oxopropanoate (PubChem CID 163284126) has the molecular formula C25H28F2N2O3 and a molecular weight of 442.51 g/mol. Its IUPAC name is benzyl 3-[(3aR,6aR)-1-benzyl-3,3-difluoro-3a,4,6,6a-tetrahydro-2H-pyrrolo[3,4-b]pyrrol-5-yl]-2,2-dimethyl-3-oxopropanoate.
| Compound Name | benzyl 3-[(3aR,6aR)-1-benzyl-3,3-difluoro-3a,4,6,6a-tetrahydro-2H-pyrrolo[3,4-b]pyrrol-5-yl]-2,2-dimethyl-3-oxopropanoate |
|---|---|
| PubChem CID | 163284126 |
| Molecular Formula | C25H28F2N2O3 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | benzyl 3-[(3aR,6aR)-1-benzyl-3,3-difluoro-3a,4,6,6a-tetrahydro-2H-pyrrolo[3,4-b]pyrrol-5-yl]-2,2-dimethyl-3-oxopropanoate |
| SMILES | CC(C)(C(=O)OCc1ccccc1)C(=O)N1C[C@@H]2[C@H](C1)N(Cc1ccccc1)CC2(F)F |
| InChI | InChI=1S/C25H28F2N2O3/c1-24(2,23(31)32-16-19-11-7-4-8-12-19)22(30)28-14-20-21(15-28)29(17-25(20,26)27)13-18-9-5-3-6-10-18/h3-12,20-21H,13-17H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | XIHUOFVRACWLGB-RTWAWAEBSA-N |
| XLogP | 3.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|