C28H34F2N2O5 — CID 163284332
benzyl (3aS,7aR)-3,3-difluoro-5-[3-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3-oxopropyl]-2,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridine-1-carboxylate (PubChem CID 163284332) has the molecular formula C28H34F2N2O5 and a molecular weight of 516.59 g/mol. Its IUPAC name is benzyl (3aS,7aR)-3,3-difluoro-5-[3-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3-oxopropyl]-2,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridine-1-carboxylate.
| Compound Name | benzyl (3aS,7aR)-3,3-difluoro-5-[3-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3-oxopropyl]-2,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 163284332 |
| Molecular Formula | C28H34F2N2O5 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | benzyl (3aS,7aR)-3,3-difluoro-5-[3-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3-oxopropyl]-2,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridine-1-carboxylate |
| SMILES | COc1ccc(COC(=O)C(C)(C)CN2CC[C@@H]3[C@H](C2)C(F)(F)CN3C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H34F2N2O5/c1-27(2,25(33)36-16-21-9-11-22(35-3)12-10-21)18-31-14-13-24-23(15-31)28(29,30)19-32(24)26(34)37-17-20-7-5-4-6-8-20/h4-12,23-24H,13-19H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | NFRCZFPRSIGENO-BJKOFHAPSA-N |
| XLogP | 4.74 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |