C19H23F2N3O4 — CID 163284019
benzyl (3aS,6aR)-5-(3-amino-2,2-dimethyl-3-oxopropyl)-3,3-difluoro-4-oxo-2,3a,6,6a-tetrahydropyrrolo[3,4-b]pyrrole-1-carboxylate (PubChem CID 163284019) has the molecular formula C19H23F2N3O4 and a molecular weight of 395.41 g/mol. Its IUPAC name is benzyl (3aS,6aR)-5-(3-amino-2,2-dimethyl-3-oxopropyl)-3,3-difluoro-4-oxo-2,3a,6,6a-tetrahydropyrrolo[3,4-b]pyrrole-1-carboxylate.
| Compound Name | benzyl (3aS,6aR)-5-(3-amino-2,2-dimethyl-3-oxopropyl)-3,3-difluoro-4-oxo-2,3a,6,6a-tetrahydropyrrolo[3,4-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 163284019 |
| Molecular Formula | C19H23F2N3O4 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | benzyl (3aS,6aR)-5-(3-amino-2,2-dimethyl-3-oxopropyl)-3,3-difluoro-4-oxo-2,3a,6,6a-tetrahydropyrrolo[3,4-b]pyrrole-1-carboxylate |
| SMILES | CC(C)(CN1C[C@H]2[C@@H](C1=O)C(F)(F)CN2C(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C19H23F2N3O4/c1-18(2,16(22)26)10-23-8-13-14(15(23)25)19(20,21)11-24(13)17(27)28-9-12-6-4-3-5-7-12/h3-7,13-14H,8-11H2,1-2H3,(H2,22,26)/t13-,14-/m0/s1 |
| InChIKey | UECFFJMATLREMU-KBPBESRZSA-N |
| XLogP | 1.61 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |