C33H28F2N2O3 — CID 163284057
benzyl (3aS,6aR)-3,3-difluoro-4-oxo-5-trityl-2,3a,6,6a-tetrahydropyrrolo[3,4-b]pyrrole-1-carboxylate (PubChem CID 163284057) has the molecular formula C33H28F2N2O3 and a molecular weight of 538.59 g/mol. Its IUPAC name is benzyl (3aS,6aR)-3,3-difluoro-4-oxo-5-trityl-2,3a,6,6a-tetrahydropyrrolo[3,4-b]pyrrole-1-carboxylate.
| Compound Name | benzyl (3aS,6aR)-3,3-difluoro-4-oxo-5-trityl-2,3a,6,6a-tetrahydropyrrolo[3,4-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 163284057 |
| Molecular Formula | C33H28F2N2O3 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | benzyl (3aS,6aR)-3,3-difluoro-4-oxo-5-trityl-2,3a,6,6a-tetrahydropyrrolo[3,4-b]pyrrole-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC(F)(F)[C@@H]2C(=O)N(C(c3ccccc3)(c3ccccc3)c3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C33H28F2N2O3/c34-32(35)23-36(31(39)40-22-24-13-5-1-6-14-24)28-21-37(30(38)29(28)32)33(25-15-7-2-8-16-25,26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-20,28-29H,21-23H2/t28-,29-/m0/s1 |
| InChIKey | XIBXKYLNQQQYDS-VMPREFPWSA-N |
| XLogP | 6.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|