C22H21F2NO4 — CID 141191716
dibenzyl (1R,3S,4S)-5,5-difluoro-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 141191716) has the molecular formula C22H21F2NO4 and a molecular weight of 401.41 g/mol. Its IUPAC name is dibenzyl (1R,3S,4S)-5,5-difluoro-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | dibenzyl (1R,3S,4S)-5,5-difluoro-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 141191716 |
| Molecular Formula | C22H21F2NO4 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | dibenzyl (1R,3S,4S)-5,5-difluoro-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1[C@@H]2C[C@H](CC2(F)F)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H21F2NO4/c23-22(24)12-17-11-18(22)19(20(26)28-13-15-7-3-1-4-8-15)25(17)21(27)29-14-16-9-5-2-6-10-16/h1-10,17-19H,11-14H2/t17-,18+,19+/m1/s1 |
| InChIKey | CPDRFPSXLADTNJ-QYZOEREBSA-N |
| XLogP | 4.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |