C20H32N2O5 — CID 175218800
3-[2-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]ethoxy]butanoic acid (PubChem CID 175218800) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[2-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]ethoxy]butanoic acid.
| Compound Name | 3-[2-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]ethoxy]butanoic acid |
|---|---|
| PubChem CID | 175218800 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 3-[2-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]ethoxy]butanoic acid |
| SMILES | CC(C)CN(CC(C)C)c1ccc(CCOC(C)CC(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H32N2O5/c1-14(2)12-21(13-15(3)4)18-7-6-17(11-19(18)22(25)26)8-9-27-16(5)10-20(23)24/h6-7,11,14-16H,8-10,12-13H2,1-5H3,(H,23,24) |
| InChIKey | HDZAKDMCGACVPW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|