C21H28N2O2S — CID 130303137
4-benzylsulfanyl-N,N-bis(2-methylpropyl)-2-nitroaniline (PubChem CID 130303137) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is 4-benzylsulfanyl-N,N-bis(2-methylpropyl)-2-nitroaniline.
| Compound Name | 4-benzylsulfanyl-N,N-bis(2-methylpropyl)-2-nitroaniline |
|---|---|
| PubChem CID | 130303137 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 4-benzylsulfanyl-N,N-bis(2-methylpropyl)-2-nitroaniline |
| SMILES | CC(C)CN(CC(C)C)c1ccc(SCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H28N2O2S/c1-16(2)13-22(14-17(3)4)20-11-10-19(12-21(20)23(24)25)26-15-18-8-6-5-7-9-18/h5-12,16-17H,13-15H2,1-4H3 |
| InChIKey | UBOJXUKJLVZUGO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|