C23H27N7O2 — CID 175218999
5-anilino-3-[(6-methoxy-2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]-1,2,4-triazine-6-carboxamide (PubChem CID 175218999) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 5-anilino-3-[(6-methoxy-2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 5-anilino-3-[(6-methoxy-2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 175218999 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 5-anilino-3-[(6-methoxy-2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)amino]-1,2,4-triazine-6-carboxamide |
| SMILES | COc1cc2c(cc1Nc1nnc(C(N)=O)c(Nc3ccccc3)n1)CN(C)CC2(C)C |
| InChI | InChI=1S/C23H27N7O2/c1-23(2)13-30(3)12-14-10-17(18(32-4)11-16(14)23)26-22-27-21(19(20(24)31)28-29-22)25-15-8-6-5-7-9-15/h5-11H,12-13H2,1-4H3,(H2,24,31)(H2,25,26,27,29) |
| InChIKey | CSVDJKUFOZEYJA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |