C24H33N7O2 — CID 175218845
5-(cyclohexylamino)-3-[(9-methoxy-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-8-yl)amino]-1,2,4-triazine-6-carboxamide (PubChem CID 175218845) has the molecular formula C24H33N7O2 and a molecular weight of 451.58 g/mol. Its IUPAC name is 5-(cyclohexylamino)-3-[(9-methoxy-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-8-yl)amino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 5-(cyclohexylamino)-3-[(9-methoxy-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-8-yl)amino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 175218845 |
| Molecular Formula | C24H33N7O2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | 5-(cyclohexylamino)-3-[(9-methoxy-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-8-yl)amino]-1,2,4-triazine-6-carboxamide |
| SMILES | COc1cc2c(cc1Nc1nnc(C(N)=O)c(NC3CCCCC3)n1)CN1CCCCC1C2 |
| InChI | InChI=1S/C24H33N7O2/c1-33-20-13-15-11-18-9-5-6-10-31(18)14-16(15)12-19(20)27-24-28-23(21(22(25)32)29-30-24)26-17-7-3-2-4-8-17/h12-13,17-18H,2-11,14H2,1H3,(H2,25,32)(H2,26,27,28,30) |
| InChIKey | BDGCYUPFWUDKOJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |