C25H26N8O2 — CID 175220780
5-(2-cyanoanilino)-3-[(9-methoxy-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-8-yl)amino]-1,2,4-triazine-6-carboxamide (PubChem CID 175220780) has the molecular formula C25H26N8O2 and a molecular weight of 470.54 g/mol. Its IUPAC name is 5-(2-cyanoanilino)-3-[(9-methoxy-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-8-yl)amino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 5-(2-cyanoanilino)-3-[(9-methoxy-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-8-yl)amino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 175220780 |
| Molecular Formula | C25H26N8O2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 5-(2-cyanoanilino)-3-[(9-methoxy-2,3,4,6,11,11a-hexahydro-1H-benzo[b]quinolizin-8-yl)amino]-1,2,4-triazine-6-carboxamide |
| SMILES | COc1cc2c(cc1Nc1nnc(C(N)=O)c(Nc3ccccc3C#N)n1)CN1CCCCC1C2 |
| InChI | InChI=1S/C25H26N8O2/c1-35-21-12-16-10-18-7-4-5-9-33(18)14-17(16)11-20(21)29-25-30-24(22(23(27)34)31-32-25)28-19-8-3-2-6-15(19)13-26/h2-3,6,8,11-12,18H,4-5,7,9-10,14H2,1H3,(H2,27,34)(H2,28,29,30,32) |
| InChIKey | BZNUDMPMIBAYLS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |