C11H10F2O3 — CID 175219580
(2,3-difluorophenyl)-(dioxan-4-yl)methanone (PubChem CID 175219580) has the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(dioxan-4-yl)methanone.
| Compound Name | (2,3-difluorophenyl)-(dioxan-4-yl)methanone |
|---|---|
| PubChem CID | 175219580 |
| Molecular Formula | C11H10F2O3 |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (2,3-difluorophenyl)-(dioxan-4-yl)methanone |
| SMILES | O=C(c1cccc(F)c1F)C1CCOOC1 |
| InChI | InChI=1S/C11H10F2O3/c12-9-3-1-2-8(10(9)13)11(14)7-4-5-15-16-6-7/h1-3,7H,4-6H2 |
| InChIKey | BJJFNCROZAGKPR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|