C14H22O4 — CID 175219736
propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate (PubChem CID 175219736) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate.
| Compound Name | propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 175219736 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate |
| SMILES | CC(C)OC(=O)C12CC3CC(C1)C(O)C(C3)C2O |
| InChI | InChI=1S/C14H22O4/c1-7(2)18-13(17)14-5-8-3-9(6-14)11(15)10(4-8)12(14)16/h7-12,15-16H,3-6H2,1-2H3 |
| InChIKey | SKEGRFDTFGZHEB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |