propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate

C14H22O4 — CID 175219736

IUPACpropan-2-yl 2,4-dihydroxyadamantane-1-carboxylate
SMILESCC(C)OC(=O)C12CC3CC(C1)C(O)C(C3)C2O
InChIInChI=1S/C14H22O4/c1-7(2)18-13(17)14-5-8-3-9(6-14)11(15)10(4-8)12(14)16/h7-12,15-16H,3-6H2,1-2H3
InChIKeySKEGRFDTFGZHEB-UHFFFAOYSA-N
MW254.33 g/mol
LogP1.10
Rot. Bonds2

About propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate

propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate (PubChem CID 175219736) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate.

Molecular Properties

Compound Namepropan-2-yl 2,4-dihydroxyadamantane-1-carboxylate
PubChem CID175219736
Molecular FormulaC14H22O4
Molecular Weight254.33 g/mol
Exact Mass254.15
IUPAC Namepropan-2-yl 2,4-dihydroxyadamantane-1-carboxylate
SMILESCC(C)OC(=O)C12CC3CC(C1)C(O)C(C3)C2O
InChIInChI=1S/C14H22O4/c1-7(2)18-13(17)14-5-8-3-9(6-14)11(15)10(4-8)12(14)16/h7-12,15-16H,3-6H2,1-2H3
InChIKeySKEGRFDTFGZHEB-UHFFFAOYSA-N
XLogP1.10
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.33
LogP ≤ 51.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate?
The IUPAC name of propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate (CID 175219736) is propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate.
What is the SMILES notation for propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate?
The canonical SMILES for propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate is CC(C)OC(=O)C12CC3CC(C1)C(O)C(C3)C2O.
What is the InChIKey of propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate?
The InChIKey is SKEGRFDTFGZHEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4/c1-7(2)18-13(17)14-5-8-3-9(6-14)11(15)10(4-8)12(14)16/h7-12,15-16H,3-6H2,1-2H3.
What are the key properties of propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate?
propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate has a molecular weight of 254.33 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2,4-dihydroxyadamantane-1-carboxylate is sourced from PubChem (CID 175219736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).