C12H19NaO7S2 — CID 175221550
sodium;hydride;3-(3-sulfohex-4-yn-3-yloxy)hex-4-yne-3-sulfonic acid (PubChem CID 175221550) has the molecular formula C12H19NaO7S2 and a molecular weight of 362.40 g/mol. Its IUPAC name is sodium;hydride;3-(3-sulfohex-4-yn-3-yloxy)hex-4-yne-3-sulfonic acid.
| Compound Name | sodium;hydride;3-(3-sulfohex-4-yn-3-yloxy)hex-4-yne-3-sulfonic acid |
|---|---|
| PubChem CID | 175221550 |
| Molecular Formula | C12H19NaO7S2 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | sodium;hydride;3-(3-sulfohex-4-yn-3-yloxy)hex-4-yne-3-sulfonic acid |
| SMILES | CC#CC(CC)(OC(C#CC)(CC)S(=O)(=O)O)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C12H18O7S2.Na.H/c1-5-9-11(7-3,20(13,14)15)19-12(8-4,10-6-2)21(16,17)18;;/h7-8H2,1-4H3,(H,13,14,15)(H,16,17,18);;/q;+1;-1 |
| InChIKey | FHPVQKGHVNKBOC-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|