About copper;octadecanoyloxyboronic acid
copper;octadecanoyloxyboronic acid (PubChem CID 175224071) has the molecular formula C18H37BCuO4
and a molecular weight of 391.85 g/mol. Its IUPAC name is copper;octadecanoyloxyboronic acid.
Molecular Properties
| Compound Name | copper;octadecanoyloxyboronic acid |
| PubChem CID | 175224071 |
| Molecular Formula | C18H37BCuO4 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | copper;octadecanoyloxyboronic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OB(O)O.[Cu] |
| InChI | InChI=1S/C18H37BO4.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)23-19(21)22;/h21-22H,2-17H2,1H3; |
| InChIKey | FOSHBYSUHQSFCA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze copper;octadecanoyloxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;octadecanoyloxyboronic acid?
The IUPAC name of copper;octadecanoyloxyboronic acid (CID 175224071) is copper;octadecanoyloxyboronic acid.
What is the SMILES notation for copper;octadecanoyloxyboronic acid?
The canonical SMILES for copper;octadecanoyloxyboronic acid is CCCCCCCCCCCCCCCCCC(=O)OB(O)O.[Cu].
What is the InChIKey of copper;octadecanoyloxyboronic acid?
The InChIKey is FOSHBYSUHQSFCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37BO4.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)23-19(21)22;/h21-22H,2-17H2,1H3;.
What are the key properties of copper;octadecanoyloxyboronic acid?
copper;octadecanoyloxyboronic acid has a molecular weight of 391.85 g/mol, XLogP of 4.76, 17 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;octadecanoyloxyboronic acid is sourced from PubChem (CID 175224071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).