About carbamothioic S-acid;methylaminomethylcarbamothioic S-acid
carbamothioic S-acid;methylaminomethylcarbamothioic S-acid (PubChem CID 175226561) has the molecular formula C4H11N3O2S2
and a molecular weight of 197.28 g/mol. Its IUPAC name is carbamothioic S-acid;methylaminomethylcarbamothioic S-acid.
Molecular Properties
| Compound Name | carbamothioic S-acid;methylaminomethylcarbamothioic S-acid |
| PubChem CID | 175226561 |
| Molecular Formula | C4H11N3O2S2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | carbamothioic S-acid;methylaminomethylcarbamothioic S-acid |
| SMILES | CNCNC(=O)S.NC(=O)S |
| InChI | InChI=1S/C3H8N2OS.CH3NOS/c1-4-2-5-3(6)7;2-1(3)4/h4H,2H2,1H3,(H2,5,6,7);(H3,2,3,4) |
| InChIKey | MIJSBEVTXSJISD-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamothioic S-acid;methylaminomethylcarbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioic S-acid;methylaminomethylcarbamothioic S-acid?
The IUPAC name of carbamothioic S-acid;methylaminomethylcarbamothioic S-acid (CID 175226561) is carbamothioic S-acid;methylaminomethylcarbamothioic S-acid.
What is the SMILES notation for carbamothioic S-acid;methylaminomethylcarbamothioic S-acid?
The canonical SMILES for carbamothioic S-acid;methylaminomethylcarbamothioic S-acid is CNCNC(=O)S.NC(=O)S.
What is the InChIKey of carbamothioic S-acid;methylaminomethylcarbamothioic S-acid?
The InChIKey is MIJSBEVTXSJISD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2OS.CH3NOS/c1-4-2-5-3(6)7;2-1(3)4/h4H,2H2,1H3,(H2,5,6,7);(H3,2,3,4).
What are the key properties of carbamothioic S-acid;methylaminomethylcarbamothioic S-acid?
carbamothioic S-acid;methylaminomethylcarbamothioic S-acid has a molecular weight of 197.28 g/mol, XLogP of -0.20, 2 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioic S-acid;methylaminomethylcarbamothioic S-acid is sourced from PubChem (CID 175226561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).